About 2-methyl-3-[4-(piperidin-2-ylmethoxy)phenyl]pyrazolo[1,5-a]pyrimidine;hydrochloride
2-methyl-3-[4-(piperidin-2-ylmethoxy)phenyl]pyrazolo[1,5-a]pyrimidine;hydrochloride (PubChem CID 163341809) has the molecular formula C19H23ClN4O
and a molecular weight of 358.87 g/mol. Its IUPAC name is 2-methyl-3-[4-(piperidin-2-ylmethoxy)phenyl]pyrazolo[1,5-a]pyrimidine;hydrochloride.
Molecular Properties
| Compound Name | 2-methyl-3-[4-(piperidin-2-ylmethoxy)phenyl]pyrazolo[1,5-a]pyrimidine;hydrochloride |
| PubChem CID | 163341809 |
| Molecular Formula | C19H23ClN4O |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 2-methyl-3-[4-(piperidin-2-ylmethoxy)phenyl]pyrazolo[1,5-a]pyrimidine;hydrochloride |
| SMILES | Cc1nn2cccnc2c1-c1ccc(OCC2CCCCN2)cc1.Cl |
| InChI | InChI=1S/C19H22N4O.ClH/c1-14-18(19-21-11-4-12-23(19)22-14)15-6-8-17(9-7-15)24-13-16-5-2-3-10-20-16;/h4,6-9,11-12,16,20H,2-3,5,10,13H2,1H3;1H |
| InChIKey | DBQZUUMHFFBPFJ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methyl-3-[4-(piperidin-2-ylmethoxy)phenyl]pyrazolo[1,5-a]pyrimidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3-[4-(piperidin-2-ylmethoxy)phenyl]pyrazolo[1,5-a]pyrimidine;hydrochloride?
The IUPAC name of 2-methyl-3-[4-(piperidin-2-ylmethoxy)phenyl]pyrazolo[1,5-a]pyrimidine;hydrochloride (CID 163341809) is 2-methyl-3-[4-(piperidin-2-ylmethoxy)phenyl]pyrazolo[1,5-a]pyrimidine;hydrochloride.
What is the SMILES notation for 2-methyl-3-[4-(piperidin-2-ylmethoxy)phenyl]pyrazolo[1,5-a]pyrimidine;hydrochloride?
The canonical SMILES for 2-methyl-3-[4-(piperidin-2-ylmethoxy)phenyl]pyrazolo[1,5-a]pyrimidine;hydrochloride is Cc1nn2cccnc2c1-c1ccc(OCC2CCCCN2)cc1.Cl.
What is the InChIKey of 2-methyl-3-[4-(piperidin-2-ylmethoxy)phenyl]pyrazolo[1,5-a]pyrimidine;hydrochloride?
The InChIKey is DBQZUUMHFFBPFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N4O.ClH/c1-14-18(19-21-11-4-12-23(19)22-14)15-6-8-17(9-7-15)24-13-16-5-2-3-10-20-16;/h4,6-9,11-12,16,20H,2-3,5,10,13H2,1H3;1H.
What are the key properties of 2-methyl-3-[4-(piperidin-2-ylmethoxy)phenyl]pyrazolo[1,5-a]pyrimidine;hydrochloride?
2-methyl-3-[4-(piperidin-2-ylmethoxy)phenyl]pyrazolo[1,5-a]pyrimidine;hydrochloride has a molecular weight of 358.87 g/mol, XLogP of 3.65, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-[4-(piperidin-2-ylmethoxy)phenyl]pyrazolo[1,5-a]pyrimidine;hydrochloride is sourced from PubChem (CID 163341809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).