About 3-bromo-2-fluoro-5-methylidenepyridin-2-ide;holmium
3-bromo-2-fluoro-5-methylidenepyridin-2-ide;holmium (PubChem CID 163342267) has the molecular formula C6H4BrFHoN-
and a molecular weight of 353.94 g/mol. Its IUPAC name is 3-bromo-2-fluoro-5-methylidenepyridin-2-ide;holmium.
Molecular Properties
| Compound Name | 3-bromo-2-fluoro-5-methylidenepyridin-2-ide;holmium |
| PubChem CID | 163342267 |
| Molecular Formula | C6H4BrFHoN- |
| Molecular Weight | 353.94 g/mol |
| Exact Mass | 352.88 |
| IUPAC Name | 3-bromo-2-fluoro-5-methylidenepyridin-2-ide;holmium |
| SMILES | C=C1C=N[C-](F)C(Br)=C1.[Ho] |
| InChI | InChI=1S/C6H4BrFN.Ho/c1-4-2-5(7)6(8)9-3-4;/h2-3H,1H2;/q-1; |
| InChIKey | BOIYQLYYOLYNGV-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.94 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-2-fluoro-5-methylidenepyridin-2-ide;holmium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2-fluoro-5-methylidenepyridin-2-ide;holmium?
The IUPAC name of 3-bromo-2-fluoro-5-methylidenepyridin-2-ide;holmium (CID 163342267) is 3-bromo-2-fluoro-5-methylidenepyridin-2-ide;holmium.
What is the SMILES notation for 3-bromo-2-fluoro-5-methylidenepyridin-2-ide;holmium?
The canonical SMILES for 3-bromo-2-fluoro-5-methylidenepyridin-2-ide;holmium is C=C1C=N[C-](F)C(Br)=C1.[Ho].
What is the InChIKey of 3-bromo-2-fluoro-5-methylidenepyridin-2-ide;holmium?
The InChIKey is BOIYQLYYOLYNGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BrFN.Ho/c1-4-2-5(7)6(8)9-3-4;/h2-3H,1H2;/q-1;.
What are the key properties of 3-bromo-2-fluoro-5-methylidenepyridin-2-ide;holmium?
3-bromo-2-fluoro-5-methylidenepyridin-2-ide;holmium has a molecular weight of 353.94 g/mol, XLogP of 2.36, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2-fluoro-5-methylidenepyridin-2-ide;holmium is sourced from PubChem (CID 163342267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).