About 5-(trifluoromethyl)-1,7-dihydrodibenzothiophen-5-ium tetrafluoroborate
5-(trifluoromethyl)-1,7-dihydrodibenzothiophen-5-ium tetrafluoroborate (PubChem CID 163342339) has the molecular formula C13H10BF7S
and a molecular weight of 342.09 g/mol. Its IUPAC name is 5-(trifluoromethyl)-1,7-dihydrodibenzothiophen-5-ium tetrafluoroborate.
Molecular Properties
| Compound Name | 5-(trifluoromethyl)-1,7-dihydrodibenzothiophen-5-ium tetrafluoroborate |
| PubChem CID | 163342339 |
| Molecular Formula | C13H10BF7S |
| Molecular Weight | 342.09 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | 5-(trifluoromethyl)-1,7-dihydrodibenzothiophen-5-ium tetrafluoroborate |
| SMILES | FC(F)(F)[s+]1c2c(c3c1=CC=CC3)C=CCC=2.F[B-](F)(F)F |
| InChI | InChI=1S/C13H10F3S.BF4/c14-13(15,16)17-11-7-3-1-5-9(11)10-6-2-4-8-12(10)17;2-1(3,4)5/h1-3,6-8H,4-5H2;/q+1;-1 |
| InChIKey | NSKAWPBBBFOJQP-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.09 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 5-(trifluoromethyl)-1,7-dihydrodibenzothiophen-5-ium tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(trifluoromethyl)-1,7-dihydrodibenzothiophen-5-ium tetrafluoroborate?
The IUPAC name of 5-(trifluoromethyl)-1,7-dihydrodibenzothiophen-5-ium tetrafluoroborate (CID 163342339) is 5-(trifluoromethyl)-1,7-dihydrodibenzothiophen-5-ium tetrafluoroborate.
What is the SMILES notation for 5-(trifluoromethyl)-1,7-dihydrodibenzothiophen-5-ium tetrafluoroborate?
The canonical SMILES for 5-(trifluoromethyl)-1,7-dihydrodibenzothiophen-5-ium tetrafluoroborate is FC(F)(F)[s+]1c2c(c3c1=CC=CC3)C=CCC=2.F[B-](F)(F)F.
What is the InChIKey of 5-(trifluoromethyl)-1,7-dihydrodibenzothiophen-5-ium tetrafluoroborate?
The InChIKey is NSKAWPBBBFOJQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10F3S.BF4/c14-13(15,16)17-11-7-3-1-5-9(11)10-6-2-4-8-12(10)17;2-1(3,4)5/h1-3,6-8H,4-5H2;/q+1;-1.
What are the key properties of 5-(trifluoromethyl)-1,7-dihydrodibenzothiophen-5-ium tetrafluoroborate?
5-(trifluoromethyl)-1,7-dihydrodibenzothiophen-5-ium tetrafluoroborate has a molecular weight of 342.09 g/mol, XLogP of 4.30, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(trifluoromethyl)-1,7-dihydrodibenzothiophen-5-ium tetrafluoroborate is sourced from PubChem (CID 163342339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).