C46H70N10O2 — CID 163342514
cyclohexane;bis(5-[[2-(dimethylamino)-2-[4-(dimethylamino)phenyl]ethyl]amino]-2-(2-methylpropyl)-1,3-oxazole-4-carbonitrile) (PubChem CID 163342514) has the molecular formula C46H70N10O2 and a molecular weight of 795.13 g/mol. Its IUPAC name is cyclohexane;bis(5-[[2-(dimethylamino)-2-[4-(dimethylamino)phenyl]ethyl]amino]-2-(2-methylpropyl)-1,3-oxazole-4-carbonitrile).
| Compound Name | cyclohexane;bis(5-[[2-(dimethylamino)-2-[4-(dimethylamino)phenyl]ethyl]amino]-2-(2-methylpropyl)-1,3-oxazole-4-carbonitrile) |
|---|---|
| PubChem CID | 163342514 |
| Molecular Formula | C46H70N10O2 |
| Molecular Weight | 795.13 g/mol |
| Exact Mass | 794.57 |
| IUPAC Name | cyclohexane;bis(5-[[2-(dimethylamino)-2-[4-(dimethylamino)phenyl]ethyl]amino]-2-(2-methylpropyl)-1,3-oxazole-4-carbonitrile) |
| SMILES | C1CCCCC1.CC(C)Cc1nc(C#N)c(NCC(c2ccc(N(C)C)cc2)N(C)C)o1.CC(C)Cc1nc(C#N)c(NCC(c2ccc(N(C)C)cc2)N(C)C)o1 |
| InChI | InChI=1S/2C20H29N5O.C6H12/c2*1-14(2)11-19-23-17(12-21)20(26-19)22-13-18(25(5)6)15-7-9-16(10-8-15)24(3)4;1-2-4-6-5-3-1/h2*7-10,14,18,22H,11,13H2,1-6H3;1-6H2 |
| InChIKey | XEYUOVXMCGPTRJ-UHFFFAOYSA-N |
| XLogP | 9.39 |
| TPSA | 136.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.13 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|