C17H36N2+2 — CID 163343251
1,1-dimethyl-4-[4-(1-methylpiperidin-1-ium-1-yl)butyl]piperidin-1-ium (PubChem CID 163343251) has the molecular formula C17H36N2+2 and a molecular weight of 268.49 g/mol. Its IUPAC name is 1,1-dimethyl-4-[4-(1-methylpiperidin-1-ium-1-yl)butyl]piperidin-1-ium.
| Compound Name | 1,1-dimethyl-4-[4-(1-methylpiperidin-1-ium-1-yl)butyl]piperidin-1-ium |
|---|---|
| PubChem CID | 163343251 |
| Molecular Formula | C17H36N2+2 |
| Molecular Weight | 268.49 g/mol |
| Exact Mass | 268.29 |
| IUPAC Name | 1,1-dimethyl-4-[4-(1-methylpiperidin-1-ium-1-yl)butyl]piperidin-1-ium |
| SMILES | C[N+]1(C)CCC(CCCC[N+]2(C)CCCCC2)CC1 |
| InChI | InChI=1S/C17H36N2/c1-18(2)15-10-17(11-16-18)9-5-8-14-19(3)12-6-4-7-13-19/h17H,4-16H2,1-3H3/q+2 |
| InChIKey | SSRVVZKCYQGOCN-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.49 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|