About 2-[1-(2-methylpyrido[3,4-d]pyrimidin-4-yl)piperidin-4-yl]oxy-1,3-thiazole
2-[1-(2-methylpyrido[3,4-d]pyrimidin-4-yl)piperidin-4-yl]oxy-1,3-thiazole (PubChem CID 163344407) has the molecular formula C16H17N5OS
and a molecular weight of 327.41 g/mol. Its IUPAC name is 2-[1-(2-methylpyrido[3,4-d]pyrimidin-4-yl)piperidin-4-yl]oxy-1,3-thiazole.
Molecular Properties
| Compound Name | 2-[1-(2-methylpyrido[3,4-d]pyrimidin-4-yl)piperidin-4-yl]oxy-1,3-thiazole |
| PubChem CID | 163344407 |
| Molecular Formula | C16H17N5OS |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 2-[1-(2-methylpyrido[3,4-d]pyrimidin-4-yl)piperidin-4-yl]oxy-1,3-thiazole |
| SMILES | Cc1nc(N2CCC(Oc3nccs3)CC2)c2ccncc2n1 |
| InChI | InChI=1S/C16H17N5OS/c1-11-19-14-10-17-5-2-13(14)15(20-11)21-7-3-12(4-8-21)22-16-18-6-9-23-16/h2,5-6,9-10,12H,3-4,7-8H2,1H3 |
| InChIKey | YBNZBASCNPJPRJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 64.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[1-(2-methylpyrido[3,4-d]pyrimidin-4-yl)piperidin-4-yl]oxy-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(2-methylpyrido[3,4-d]pyrimidin-4-yl)piperidin-4-yl]oxy-1,3-thiazole?
The IUPAC name of 2-[1-(2-methylpyrido[3,4-d]pyrimidin-4-yl)piperidin-4-yl]oxy-1,3-thiazole (CID 163344407) is 2-[1-(2-methylpyrido[3,4-d]pyrimidin-4-yl)piperidin-4-yl]oxy-1,3-thiazole.
What is the SMILES notation for 2-[1-(2-methylpyrido[3,4-d]pyrimidin-4-yl)piperidin-4-yl]oxy-1,3-thiazole?
The canonical SMILES for 2-[1-(2-methylpyrido[3,4-d]pyrimidin-4-yl)piperidin-4-yl]oxy-1,3-thiazole is Cc1nc(N2CCC(Oc3nccs3)CC2)c2ccncc2n1.
What is the InChIKey of 2-[1-(2-methylpyrido[3,4-d]pyrimidin-4-yl)piperidin-4-yl]oxy-1,3-thiazole?
The InChIKey is YBNZBASCNPJPRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N5OS/c1-11-19-14-10-17-5-2-13(14)15(20-11)21-7-3-12(4-8-21)22-16-18-6-9-23-16/h2,5-6,9-10,12H,3-4,7-8H2,1H3.
What are the key properties of 2-[1-(2-methylpyrido[3,4-d]pyrimidin-4-yl)piperidin-4-yl]oxy-1,3-thiazole?
2-[1-(2-methylpyrido[3,4-d]pyrimidin-4-yl)piperidin-4-yl]oxy-1,3-thiazole has a molecular weight of 327.41 g/mol, XLogP of 2.84, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(2-methylpyrido[3,4-d]pyrimidin-4-yl)piperidin-4-yl]oxy-1,3-thiazole is sourced from PubChem (CID 163344407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).