C12H15F3N2O — CID 163345314
3-methoxy-2-[4-(trifluoromethyl)piperidin-1-yl]pyridine (PubChem CID 163345314) has the molecular formula C12H15F3N2O and a molecular weight of 260.26 g/mol. Its IUPAC name is 3-methoxy-2-[4-(trifluoromethyl)piperidin-1-yl]pyridine.
| Compound Name | 3-methoxy-2-[4-(trifluoromethyl)piperidin-1-yl]pyridine |
|---|---|
| PubChem CID | 163345314 |
| Molecular Formula | C12H15F3N2O |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 3-methoxy-2-[4-(trifluoromethyl)piperidin-1-yl]pyridine |
| SMILES | COc1cccnc1N1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H15F3N2O/c1-18-10-3-2-6-16-11(10)17-7-4-9(5-8-17)12(13,14)15/h2-3,6,9H,4-5,7-8H2,1H3 |
| InChIKey | MVBHNLKUWWPWEV-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |