C14H14N6O2 — CID 163345938
3-[3-(5-methoxypyrimidin-2-yl)oxypyrrolidin-1-yl]pyrazine-2-carbonitrile (PubChem CID 163345938) has the molecular formula C14H14N6O2 and a molecular weight of 298.31 g/mol. Its IUPAC name is 3-[3-(5-methoxypyrimidin-2-yl)oxypyrrolidin-1-yl]pyrazine-2-carbonitrile.
| Compound Name | 3-[3-(5-methoxypyrimidin-2-yl)oxypyrrolidin-1-yl]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 163345938 |
| Molecular Formula | C14H14N6O2 |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 3-[3-(5-methoxypyrimidin-2-yl)oxypyrrolidin-1-yl]pyrazine-2-carbonitrile |
| SMILES | COc1cnc(OC2CCN(c3nccnc3C#N)C2)nc1 |
| InChI | InChI=1S/C14H14N6O2/c1-21-11-7-18-14(19-8-11)22-10-2-5-20(9-10)13-12(6-15)16-3-4-17-13/h3-4,7-8,10H,2,5,9H2,1H3 |
| InChIKey | UQDZBOXVQGTIED-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 97.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |