C14H20ClN3O2S — CID 163346294
N-[1-(5-chloro-2-pyridinyl)piperidin-3-yl]-N-methylcyclopropanesulfonamide (PubChem CID 163346294) has the molecular formula C14H20ClN3O2S and a molecular weight of 329.85 g/mol. Its IUPAC name is N-[1-(5-chloro-2-pyridinyl)piperidin-3-yl]-N-methylcyclopropanesulfonamide.
| Compound Name | N-[1-(5-chloro-2-pyridinyl)piperidin-3-yl]-N-methylcyclopropanesulfonamide |
|---|---|
| PubChem CID | 163346294 |
| Molecular Formula | C14H20ClN3O2S |
| Molecular Weight | 329.85 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | N-[1-(5-chloro-2-pyridinyl)piperidin-3-yl]-N-methylcyclopropanesulfonamide |
| SMILES | CN(C1CCCN(c2ccc(Cl)cn2)C1)S(=O)(=O)C1CC1 |
| InChI | InChI=1S/C14H20ClN3O2S/c1-17(21(19,20)13-5-6-13)12-3-2-8-18(10-12)14-7-4-11(15)9-16-14/h4,7,9,12-13H,2-3,5-6,8,10H2,1H3 |
| InChIKey | KQJKLIGPGHQLHA-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.85 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |