C22H23F3N4O — CID 163346611
1-(2,3-dihydroindol-1-yl)-2-[5-[5-(trifluoromethyl)-2-pyridinyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]ethanone (PubChem CID 163346611) has the molecular formula C22H23F3N4O and a molecular weight of 416.45 g/mol. Its IUPAC name is 1-(2,3-dihydroindol-1-yl)-2-[5-[5-(trifluoromethyl)-2-pyridinyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]ethanone.
| Compound Name | 1-(2,3-dihydroindol-1-yl)-2-[5-[5-(trifluoromethyl)-2-pyridinyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]ethanone |
|---|---|
| PubChem CID | 163346611 |
| Molecular Formula | C22H23F3N4O |
| Molecular Weight | 416.45 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 1-(2,3-dihydroindol-1-yl)-2-[5-[5-(trifluoromethyl)-2-pyridinyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]ethanone |
| SMILES | O=C(CN1CCC2CN(c3ccc(C(F)(F)F)cn3)CC21)N1CCc2ccccc21 |
| InChI | InChI=1S/C22H23F3N4O/c23-22(24,25)17-5-6-20(26-11-17)28-12-16-7-9-27(19(16)13-28)14-21(30)29-10-8-15-3-1-2-4-18(15)29/h1-6,11,16,19H,7-10,12-14H2 |
| InChIKey | WFBAJBBJCKHIQL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |