C16H15ClFN5O3 — CID 163347150
ethyl 6-(chloromethyl)-4-[1-(4-fluorophenyl)triazol-4-yl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 163347150) has the molecular formula C16H15ClFN5O3 and a molecular weight of 379.78 g/mol. Its IUPAC name is ethyl 6-(chloromethyl)-4-[1-(4-fluorophenyl)triazol-4-yl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl 6-(chloromethyl)-4-[1-(4-fluorophenyl)triazol-4-yl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 163347150 |
| Molecular Formula | C16H15ClFN5O3 |
| Molecular Weight | 379.78 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | ethyl 6-(chloromethyl)-4-[1-(4-fluorophenyl)triazol-4-yl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(CCl)NC(=O)NC1c1cn(-c2ccc(F)cc2)nn1 |
| InChI | InChI=1S/C16H15ClFN5O3/c1-2-26-15(24)13-11(7-17)19-16(25)20-14(13)12-8-23(22-21-12)10-5-3-9(18)4-6-10/h3-6,8,14H,2,7H2,1H3,(H2,19,20,25) |
| InChIKey | JPVWZHOKQFGMPR-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.78 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|