C19H17ClN2O3S — CID 163347266
N'-(3-chloro-4-methylphenyl)-N-[2-[5-(furan-2-yl)thiophen-2-yl]ethyl]oxamide (PubChem CID 163347266) has the molecular formula C19H17ClN2O3S and a molecular weight of 388.88 g/mol. Its IUPAC name is N'-(3-chloro-4-methylphenyl)-N-[2-[5-(furan-2-yl)thiophen-2-yl]ethyl]oxamide.
| Compound Name | N'-(3-chloro-4-methylphenyl)-N-[2-[5-(furan-2-yl)thiophen-2-yl]ethyl]oxamide |
|---|---|
| PubChem CID | 163347266 |
| Molecular Formula | C19H17ClN2O3S |
| Molecular Weight | 388.88 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | N'-(3-chloro-4-methylphenyl)-N-[2-[5-(furan-2-yl)thiophen-2-yl]ethyl]oxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)NCCc2ccc(-c3ccco3)s2)cc1Cl |
| InChI | InChI=1S/C19H17ClN2O3S/c1-12-4-5-13(11-15(12)20)22-19(24)18(23)21-9-8-14-6-7-17(26-14)16-3-2-10-25-16/h2-7,10-11H,8-9H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | NZWAXBRRFPNLFU-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.88 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|