About 5-(dimethylamino)-2-[(Z)-2-hydroxy-1-phenylethenyl]-1,3-oxazole-4-carbonitrile
5-(dimethylamino)-2-[(Z)-2-hydroxy-1-phenylethenyl]-1,3-oxazole-4-carbonitrile (PubChem CID 163347749) has the molecular formula C14H13N3O2
and a molecular weight of 255.28 g/mol. Its IUPAC name is 5-(dimethylamino)-2-[(Z)-2-hydroxy-1-phenylethenyl]-1,3-oxazole-4-carbonitrile.
Molecular Properties
| Compound Name | 5-(dimethylamino)-2-[(Z)-2-hydroxy-1-phenylethenyl]-1,3-oxazole-4-carbonitrile |
| PubChem CID | 163347749 |
| Molecular Formula | C14H13N3O2 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 5-(dimethylamino)-2-[(Z)-2-hydroxy-1-phenylethenyl]-1,3-oxazole-4-carbonitrile |
| SMILES | CN(C)c1oc(/C(=C\O)c2ccccc2)nc1C#N |
| InChI | InChI=1S/C14H13N3O2/c1-17(2)14-12(8-15)16-13(19-14)11(9-18)10-6-4-3-5-7-10/h3-7,9,18H,1-2H3/b11-9- |
| InChIKey | KHHSWRJRYSGWPX-LUAWRHEFSA-N |
| XLogP | 2.56 |
| TPSA | 73.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 5-(dimethylamino)-2-[(Z)-2-hydroxy-1-phenylethenyl]-1,3-oxazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(dimethylamino)-2-[(Z)-2-hydroxy-1-phenylethenyl]-1,3-oxazole-4-carbonitrile?
The IUPAC name of 5-(dimethylamino)-2-[(Z)-2-hydroxy-1-phenylethenyl]-1,3-oxazole-4-carbonitrile (CID 163347749) is 5-(dimethylamino)-2-[(Z)-2-hydroxy-1-phenylethenyl]-1,3-oxazole-4-carbonitrile.
What is the SMILES notation for 5-(dimethylamino)-2-[(Z)-2-hydroxy-1-phenylethenyl]-1,3-oxazole-4-carbonitrile?
The canonical SMILES for 5-(dimethylamino)-2-[(Z)-2-hydroxy-1-phenylethenyl]-1,3-oxazole-4-carbonitrile is CN(C)c1oc(/C(=C\O)c2ccccc2)nc1C#N.
What is the InChIKey of 5-(dimethylamino)-2-[(Z)-2-hydroxy-1-phenylethenyl]-1,3-oxazole-4-carbonitrile?
The InChIKey is KHHSWRJRYSGWPX-LUAWRHEFSA-N. The full InChI is InChI=1S/C14H13N3O2/c1-17(2)14-12(8-15)16-13(19-14)11(9-18)10-6-4-3-5-7-10/h3-7,9,18H,1-2H3/b11-9-.
What are the key properties of 5-(dimethylamino)-2-[(Z)-2-hydroxy-1-phenylethenyl]-1,3-oxazole-4-carbonitrile?
5-(dimethylamino)-2-[(Z)-2-hydroxy-1-phenylethenyl]-1,3-oxazole-4-carbonitrile has a molecular weight of 255.28 g/mol, XLogP of 2.56, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(dimethylamino)-2-[(Z)-2-hydroxy-1-phenylethenyl]-1,3-oxazole-4-carbonitrile is sourced from PubChem (CID 163347749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).