About 6-(2,6-dimethylmorpholin-4-yl)-7,9-dimethylpurin-8-one
6-(2,6-dimethylmorpholin-4-yl)-7,9-dimethylpurin-8-one (PubChem CID 163347986) has the molecular formula C13H19N5O2
and a molecular weight of 277.33 g/mol. Its IUPAC name is 6-(2,6-dimethylmorpholin-4-yl)-7,9-dimethylpurin-8-one.
Molecular Properties
| Compound Name | 6-(2,6-dimethylmorpholin-4-yl)-7,9-dimethylpurin-8-one |
| PubChem CID | 163347986 |
| Molecular Formula | C13H19N5O2 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 6-(2,6-dimethylmorpholin-4-yl)-7,9-dimethylpurin-8-one |
| SMILES | CC1CN(c2ncnc3c2n(C)c(=O)n3C)CC(C)O1 |
| InChI | InChI=1S/C13H19N5O2/c1-8-5-18(6-9(2)20-8)12-10-11(14-7-15-12)17(4)13(19)16(10)3/h7-9H,5-6H2,1-4H3 |
| InChIKey | BGUMKISABKUWHE-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 65.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-(2,6-dimethylmorpholin-4-yl)-7,9-dimethylpurin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,6-dimethylmorpholin-4-yl)-7,9-dimethylpurin-8-one?
The IUPAC name of 6-(2,6-dimethylmorpholin-4-yl)-7,9-dimethylpurin-8-one (CID 163347986) is 6-(2,6-dimethylmorpholin-4-yl)-7,9-dimethylpurin-8-one.
What is the SMILES notation for 6-(2,6-dimethylmorpholin-4-yl)-7,9-dimethylpurin-8-one?
The canonical SMILES for 6-(2,6-dimethylmorpholin-4-yl)-7,9-dimethylpurin-8-one is CC1CN(c2ncnc3c2n(C)c(=O)n3C)CC(C)O1.
What is the InChIKey of 6-(2,6-dimethylmorpholin-4-yl)-7,9-dimethylpurin-8-one?
The InChIKey is BGUMKISABKUWHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N5O2/c1-8-5-18(6-9(2)20-8)12-10-11(14-7-15-12)17(4)13(19)16(10)3/h7-9H,5-6H2,1-4H3.
What are the key properties of 6-(2,6-dimethylmorpholin-4-yl)-7,9-dimethylpurin-8-one?
6-(2,6-dimethylmorpholin-4-yl)-7,9-dimethylpurin-8-one has a molecular weight of 277.33 g/mol, XLogP of 0.28, 1 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,6-dimethylmorpholin-4-yl)-7,9-dimethylpurin-8-one is sourced from PubChem (CID 163347986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).