C15H16N4O — CID 163348210
2-[2-(4-methoxyphenyl)ethyl-methylamino]pyrimidine-4-carbonitrile (PubChem CID 163348210) has the molecular formula C15H16N4O and a molecular weight of 268.32 g/mol. Its IUPAC name is 2-[2-(4-methoxyphenyl)ethyl-methylamino]pyrimidine-4-carbonitrile.
| Compound Name | 2-[2-(4-methoxyphenyl)ethyl-methylamino]pyrimidine-4-carbonitrile |
|---|---|
| PubChem CID | 163348210 |
| Molecular Formula | C15H16N4O |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 2-[2-(4-methoxyphenyl)ethyl-methylamino]pyrimidine-4-carbonitrile |
| SMILES | COc1ccc(CCN(C)c2nccc(C#N)n2)cc1 |
| InChI | InChI=1S/C15H16N4O/c1-19(15-17-9-7-13(11-16)18-15)10-8-12-3-5-14(20-2)6-4-12/h3-7,9H,8,10H2,1-2H3 |
| InChIKey | WEFSHMNTVYYIGA-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 62.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |