About 4-(6-cyclopropyl-1,8-naphthyridin-2-yl)-N-prop-2-enylpiperidine-1-carboxamide
4-(6-cyclopropyl-1,8-naphthyridin-2-yl)-N-prop-2-enylpiperidine-1-carboxamide (PubChem CID 163348357) has the molecular formula C20H24N4O
and a molecular weight of 336.44 g/mol. Its IUPAC name is 4-(6-cyclopropyl-1,8-naphthyridin-2-yl)-N-prop-2-enylpiperidine-1-carboxamide.
Molecular Properties
| Compound Name | 4-(6-cyclopropyl-1,8-naphthyridin-2-yl)-N-prop-2-enylpiperidine-1-carboxamide |
| PubChem CID | 163348357 |
| Molecular Formula | C20H24N4O |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 4-(6-cyclopropyl-1,8-naphthyridin-2-yl)-N-prop-2-enylpiperidine-1-carboxamide |
| SMILES | C=CCNC(=O)N1CCC(c2ccc3cc(C4CC4)cnc3n2)CC1 |
| InChI | InChI=1S/C20H24N4O/c1-2-9-21-20(25)24-10-7-15(8-11-24)18-6-5-16-12-17(14-3-4-14)13-22-19(16)23-18/h2,5-6,12-15H,1,3-4,7-11H2,(H,21,25) |
| InChIKey | PQUQPHZGVLKYLD-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(6-cyclopropyl-1,8-naphthyridin-2-yl)-N-prop-2-enylpiperidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-cyclopropyl-1,8-naphthyridin-2-yl)-N-prop-2-enylpiperidine-1-carboxamide?
The IUPAC name of 4-(6-cyclopropyl-1,8-naphthyridin-2-yl)-N-prop-2-enylpiperidine-1-carboxamide (CID 163348357) is 4-(6-cyclopropyl-1,8-naphthyridin-2-yl)-N-prop-2-enylpiperidine-1-carboxamide.
What is the SMILES notation for 4-(6-cyclopropyl-1,8-naphthyridin-2-yl)-N-prop-2-enylpiperidine-1-carboxamide?
The canonical SMILES for 4-(6-cyclopropyl-1,8-naphthyridin-2-yl)-N-prop-2-enylpiperidine-1-carboxamide is C=CCNC(=O)N1CCC(c2ccc3cc(C4CC4)cnc3n2)CC1.
What is the InChIKey of 4-(6-cyclopropyl-1,8-naphthyridin-2-yl)-N-prop-2-enylpiperidine-1-carboxamide?
The InChIKey is PQUQPHZGVLKYLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N4O/c1-2-9-21-20(25)24-10-7-15(8-11-24)18-6-5-16-12-17(14-3-4-14)13-22-19(16)23-18/h2,5-6,12-15H,1,3-4,7-11H2,(H,21,25).
What are the key properties of 4-(6-cyclopropyl-1,8-naphthyridin-2-yl)-N-prop-2-enylpiperidine-1-carboxamide?
4-(6-cyclopropyl-1,8-naphthyridin-2-yl)-N-prop-2-enylpiperidine-1-carboxamide has a molecular weight of 336.44 g/mol, XLogP of 3.58, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-cyclopropyl-1,8-naphthyridin-2-yl)-N-prop-2-enylpiperidine-1-carboxamide is sourced from PubChem (CID 163348357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).