C20H24N4O — CID 163348357
4-(6-cyclopropyl-1,8-naphthyridin-2-yl)-N-prop-2-enylpiperidine-1-carboxamide (PubChem CID 163348357) has the molecular formula C20H24N4O and a molecular weight of 336.44 g/mol. Its IUPAC name is 4-(6-cyclopropyl-1,8-naphthyridin-2-yl)-N-prop-2-enylpiperidine-1-carboxamide.
| Compound Name | 4-(6-cyclopropyl-1,8-naphthyridin-2-yl)-N-prop-2-enylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 163348357 |
| Molecular Formula | C20H24N4O |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 4-(6-cyclopropyl-1,8-naphthyridin-2-yl)-N-prop-2-enylpiperidine-1-carboxamide |
| SMILES | C=CCNC(=O)N1CCC(c2ccc3cc(C4CC4)cnc3n2)CC1 |
| InChI | InChI=1S/C20H24N4O/c1-2-9-21-20(25)24-10-7-15(8-11-24)18-6-5-16-12-17(14-3-4-14)13-22-19(16)23-18/h2,5-6,12-15H,1,3-4,7-11H2,(H,21,25) |
| InChIKey | PQUQPHZGVLKYLD-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|