C20H22N4O2 — CID 163349344
5-benzyl-2-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-ylmethyl)-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,6-dione (PubChem CID 163349344) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is 5-benzyl-2-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-ylmethyl)-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,6-dione.
| Compound Name | 5-benzyl-2-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-ylmethyl)-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 163349344 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 5-benzyl-2-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-ylmethyl)-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,6-dione |
| SMILES | O=C1C2CN(Cc3n[nH]c4c3CCC4)CC2C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C20H22N4O2/c25-19-15-10-23(12-18-14-7-4-8-17(14)21-22-18)11-16(15)20(26)24(19)9-13-5-2-1-3-6-13/h1-3,5-6,15-16H,4,7-12H2,(H,21,22) |
| InChIKey | AOGXOIJSDXJEBB-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|