About 4-(4-benzylphenyl)-1,3-selenazol-2-amine
4-(4-benzylphenyl)-1,3-selenazol-2-amine (PubChem CID 163349486) has the molecular formula C16H14N2Se
and a molecular weight of 313.26 g/mol. Its IUPAC name is 4-(4-benzylphenyl)-1,3-selenazol-2-amine.
Molecular Properties
| Compound Name | 4-(4-benzylphenyl)-1,3-selenazol-2-amine |
| PubChem CID | 163349486 |
| Molecular Formula | C16H14N2Se |
| Molecular Weight | 313.26 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | 4-(4-benzylphenyl)-1,3-selenazol-2-amine |
| SMILES | Nc1nc(-c2ccc(Cc3ccccc3)cc2)c[se]1 |
| InChI | InChI=1S/C16H14N2Se/c17-16-18-15(11-19-16)14-8-6-13(7-9-14)10-12-4-2-1-3-5-12/h1-9,11H,10H2,(H2,17,18) |
| InChIKey | TVNNGQGXOFXDAF-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.26 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-benzylphenyl)-1,3-selenazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-benzylphenyl)-1,3-selenazol-2-amine?
The IUPAC name of 4-(4-benzylphenyl)-1,3-selenazol-2-amine (CID 163349486) is 4-(4-benzylphenyl)-1,3-selenazol-2-amine.
What is the SMILES notation for 4-(4-benzylphenyl)-1,3-selenazol-2-amine?
The canonical SMILES for 4-(4-benzylphenyl)-1,3-selenazol-2-amine is Nc1nc(-c2ccc(Cc3ccccc3)cc2)c[se]1.
What is the InChIKey of 4-(4-benzylphenyl)-1,3-selenazol-2-amine?
The InChIKey is TVNNGQGXOFXDAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2Se/c17-16-18-15(11-19-16)14-8-6-13(7-9-14)10-12-4-2-1-3-5-12/h1-9,11H,10H2,(H2,17,18).
What are the key properties of 4-(4-benzylphenyl)-1,3-selenazol-2-amine?
4-(4-benzylphenyl)-1,3-selenazol-2-amine has a molecular weight of 313.26 g/mol, XLogP of 2.98, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-benzylphenyl)-1,3-selenazol-2-amine is sourced from PubChem (CID 163349486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).