C18H18FN3O2 — CID 163349792
2-(4-fluorophenyl)-5-(oxan-3-ylmethyl)pyrazolo[1,5-a]pyrazin-4-one (PubChem CID 163349792) has the molecular formula C18H18FN3O2 and a molecular weight of 327.36 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-5-(oxan-3-ylmethyl)pyrazolo[1,5-a]pyrazin-4-one.
| Compound Name | 2-(4-fluorophenyl)-5-(oxan-3-ylmethyl)pyrazolo[1,5-a]pyrazin-4-one |
|---|---|
| PubChem CID | 163349792 |
| Molecular Formula | C18H18FN3O2 |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 2-(4-fluorophenyl)-5-(oxan-3-ylmethyl)pyrazolo[1,5-a]pyrazin-4-one |
| SMILES | O=c1c2cc(-c3ccc(F)cc3)nn2ccn1CC1CCCOC1 |
| InChI | InChI=1S/C18H18FN3O2/c19-15-5-3-14(4-6-15)16-10-17-18(23)21(7-8-22(17)20-16)11-13-2-1-9-24-12-13/h3-8,10,13H,1-2,9,11-12H2 |
| InChIKey | YLIJBVVBFPMKGR-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |