C13H13FN2O2 — CID 163349855
1-(3-fluorophenyl)-4-propylpyrazine-2,3-dione (PubChem CID 163349855) has the molecular formula C13H13FN2O2 and a molecular weight of 248.26 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-4-propylpyrazine-2,3-dione.
| Compound Name | 1-(3-fluorophenyl)-4-propylpyrazine-2,3-dione |
|---|---|
| PubChem CID | 163349855 |
| Molecular Formula | C13H13FN2O2 |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 1-(3-fluorophenyl)-4-propylpyrazine-2,3-dione |
| SMILES | CCCn1ccn(-c2cccc(F)c2)c(=O)c1=O |
| InChI | InChI=1S/C13H13FN2O2/c1-2-6-15-7-8-16(13(18)12(15)17)11-5-3-4-10(14)9-11/h3-5,7-9H,2,6H2,1H3 |
| InChIKey | HWPYPFZSTBDPHS-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|