C14H12FN3OS — CID 163349959
3-cyclopropyl-8-fluoro-5-methyl-2-sulfanylidene-1H-pyrimido[5,4-b]indol-4-one (PubChem CID 163349959) has the molecular formula C14H12FN3OS and a molecular weight of 289.33 g/mol. Its IUPAC name is 3-cyclopropyl-8-fluoro-5-methyl-2-sulfanylidene-1H-pyrimido[5,4-b]indol-4-one.
| Compound Name | 3-cyclopropyl-8-fluoro-5-methyl-2-sulfanylidene-1H-pyrimido[5,4-b]indol-4-one |
|---|---|
| PubChem CID | 163349959 |
| Molecular Formula | C14H12FN3OS |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 3-cyclopropyl-8-fluoro-5-methyl-2-sulfanylidene-1H-pyrimido[5,4-b]indol-4-one |
| SMILES | Cn1c2ccc(F)cc2c2[nH]c(=S)n(C3CC3)c(=O)c21 |
| InChI | InChI=1S/C14H12FN3OS/c1-17-10-5-2-7(15)6-9(10)11-12(17)13(19)18(8-3-4-8)14(20)16-11/h2,5-6,8H,3-4H2,1H3,(H,16,20) |
| InChIKey | QLQMKQIUDIYWAT-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 42.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|