C17H27N5O — CID 163350972
1-[[4-(4-pyrrolidin-1-ylpyrimidin-2-yl)piperazin-1-yl]methyl]cyclobutan-1-ol (PubChem CID 163350972) has the molecular formula C17H27N5O and a molecular weight of 317.44 g/mol. Its IUPAC name is 1-[[4-(4-pyrrolidin-1-ylpyrimidin-2-yl)piperazin-1-yl]methyl]cyclobutan-1-ol.
| Compound Name | 1-[[4-(4-pyrrolidin-1-ylpyrimidin-2-yl)piperazin-1-yl]methyl]cyclobutan-1-ol |
|---|---|
| PubChem CID | 163350972 |
| Molecular Formula | C17H27N5O |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.22 |
| IUPAC Name | 1-[[4-(4-pyrrolidin-1-ylpyrimidin-2-yl)piperazin-1-yl]methyl]cyclobutan-1-ol |
| SMILES | OC1(CN2CCN(c3nccc(N4CCCC4)n3)CC2)CCC1 |
| InChI | InChI=1S/C17H27N5O/c23-17(5-3-6-17)14-20-10-12-22(13-11-20)16-18-7-4-15(19-16)21-8-1-2-9-21/h4,7,23H,1-3,5-6,8-14H2 |
| InChIKey | CKBFNIOVNOQHOO-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |