About 2-[2-(4,4-difluoropiperidine-1-carbonyl)morpholin-4-yl]-N-propan-2-ylacetamide
2-[2-(4,4-difluoropiperidine-1-carbonyl)morpholin-4-yl]-N-propan-2-ylacetamide (PubChem CID 163352503) has the molecular formula C15H25F2N3O3
and a molecular weight of 333.38 g/mol. Its IUPAC name is 2-[2-(4,4-difluoropiperidine-1-carbonyl)morpholin-4-yl]-N-propan-2-ylacetamide.
Molecular Properties
| Compound Name | 2-[2-(4,4-difluoropiperidine-1-carbonyl)morpholin-4-yl]-N-propan-2-ylacetamide |
| PubChem CID | 163352503 |
| Molecular Formula | C15H25F2N3O3 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 2-[2-(4,4-difluoropiperidine-1-carbonyl)morpholin-4-yl]-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)CN1CCOC(C(=O)N2CCC(F)(F)CC2)C1 |
| InChI | InChI=1S/C15H25F2N3O3/c1-11(2)18-13(21)10-19-7-8-23-12(9-19)14(22)20-5-3-15(16,17)4-6-20/h11-12H,3-10H2,1-2H3,(H,18,21) |
| InChIKey | KOVVQSHVNCRNPE-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-(4,4-difluoropiperidine-1-carbonyl)morpholin-4-yl]-N-propan-2-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(4,4-difluoropiperidine-1-carbonyl)morpholin-4-yl]-N-propan-2-ylacetamide?
The IUPAC name of 2-[2-(4,4-difluoropiperidine-1-carbonyl)morpholin-4-yl]-N-propan-2-ylacetamide (CID 163352503) is 2-[2-(4,4-difluoropiperidine-1-carbonyl)morpholin-4-yl]-N-propan-2-ylacetamide.
What is the SMILES notation for 2-[2-(4,4-difluoropiperidine-1-carbonyl)morpholin-4-yl]-N-propan-2-ylacetamide?
The canonical SMILES for 2-[2-(4,4-difluoropiperidine-1-carbonyl)morpholin-4-yl]-N-propan-2-ylacetamide is CC(C)NC(=O)CN1CCOC(C(=O)N2CCC(F)(F)CC2)C1.
What is the InChIKey of 2-[2-(4,4-difluoropiperidine-1-carbonyl)morpholin-4-yl]-N-propan-2-ylacetamide?
The InChIKey is KOVVQSHVNCRNPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25F2N3O3/c1-11(2)18-13(21)10-19-7-8-23-12(9-19)14(22)20-5-3-15(16,17)4-6-20/h11-12H,3-10H2,1-2H3,(H,18,21).
What are the key properties of 2-[2-(4,4-difluoropiperidine-1-carbonyl)morpholin-4-yl]-N-propan-2-ylacetamide?
2-[2-(4,4-difluoropiperidine-1-carbonyl)morpholin-4-yl]-N-propan-2-ylacetamide has a molecular weight of 333.38 g/mol, XLogP of 0.47, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(4,4-difluoropiperidine-1-carbonyl)morpholin-4-yl]-N-propan-2-ylacetamide is sourced from PubChem (CID 163352503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).