C9H14N4O2 — CID 163353124
methyl 1-piperidin-3-yl-1,2,4-triazole-3-carboxylate (PubChem CID 163353124) has the molecular formula C9H14N4O2 and a molecular weight of 210.24 g/mol. Its IUPAC name is methyl 1-piperidin-3-yl-1,2,4-triazole-3-carboxylate.
| Compound Name | methyl 1-piperidin-3-yl-1,2,4-triazole-3-carboxylate |
|---|---|
| PubChem CID | 163353124 |
| Molecular Formula | C9H14N4O2 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | methyl 1-piperidin-3-yl-1,2,4-triazole-3-carboxylate |
| SMILES | COC(=O)c1ncn(C2CCCNC2)n1 |
| InChI | InChI=1S/C9H14N4O2/c1-15-9(14)8-11-6-13(12-8)7-3-2-4-10-5-7/h6-7,10H,2-5H2,1H3 |
| InChIKey | HLLZHZMEOKFHJK-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |