C19H22ClN5O2 — CID 163353307
3-[2-[2-(5-chloro-2-pyridinyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-oxoethyl]-5,6-dimethylpyrimidin-4-one (PubChem CID 163353307) has the molecular formula C19H22ClN5O2 and a molecular weight of 387.87 g/mol. Its IUPAC name is 3-[2-[2-(5-chloro-2-pyridinyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-oxoethyl]-5,6-dimethylpyrimidin-4-one.
| Compound Name | 3-[2-[2-(5-chloro-2-pyridinyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-oxoethyl]-5,6-dimethylpyrimidin-4-one |
|---|---|
| PubChem CID | 163353307 |
| Molecular Formula | C19H22ClN5O2 |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 3-[2-[2-(5-chloro-2-pyridinyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-oxoethyl]-5,6-dimethylpyrimidin-4-one |
| SMILES | Cc1ncn(CC(=O)N2CC3CN(c4ccc(Cl)cn4)CC3C2)c(=O)c1C |
| InChI | InChI=1S/C19H22ClN5O2/c1-12-13(2)22-11-25(19(12)27)10-18(26)24-8-14-6-23(7-15(14)9-24)17-4-3-16(20)5-21-17/h3-5,11,14-15H,6-10H2,1-2H3 |
| InChIKey | PNDLCRSOXRYFTD-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |