C15H13F3N4O2 — CID 163353329
(5-methylpyrazin-2-yl)-[3-[[2-(trifluoromethyl)-4-pyridinyl]oxy]azetidin-1-yl]methanone (PubChem CID 163353329) has the molecular formula C15H13F3N4O2 and a molecular weight of 338.29 g/mol. Its IUPAC name is (5-methylpyrazin-2-yl)-[3-[[2-(trifluoromethyl)-4-pyridinyl]oxy]azetidin-1-yl]methanone.
| Compound Name | (5-methylpyrazin-2-yl)-[3-[[2-(trifluoromethyl)-4-pyridinyl]oxy]azetidin-1-yl]methanone |
|---|---|
| PubChem CID | 163353329 |
| Molecular Formula | C15H13F3N4O2 |
| Molecular Weight | 338.29 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | (5-methylpyrazin-2-yl)-[3-[[2-(trifluoromethyl)-4-pyridinyl]oxy]azetidin-1-yl]methanone |
| SMILES | Cc1cnc(C(=O)N2CC(Oc3ccnc(C(F)(F)F)c3)C2)cn1 |
| InChI | InChI=1S/C15H13F3N4O2/c1-9-5-21-12(6-20-9)14(23)22-7-11(8-22)24-10-2-3-19-13(4-10)15(16,17)18/h2-6,11H,7-8H2,1H3 |
| InChIKey | YECLHQUBZYAMCD-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.29 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |