C17H17BrFN3O2S — CID 163353476
2-(5-bromo-2-pyridinyl)-5-(2-fluorophenyl)sulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 163353476) has the molecular formula C17H17BrFN3O2S and a molecular weight of 426.31 g/mol. Its IUPAC name is 2-(5-bromo-2-pyridinyl)-5-(2-fluorophenyl)sulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | 2-(5-bromo-2-pyridinyl)-5-(2-fluorophenyl)sulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 163353476 |
| Molecular Formula | C17H17BrFN3O2S |
| Molecular Weight | 426.31 g/mol |
| Exact Mass | 425.02 |
| IUPAC Name | 2-(5-bromo-2-pyridinyl)-5-(2-fluorophenyl)sulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | O=S(=O)(c1ccccc1F)N1CC2CN(c3ccc(Br)cn3)CC2C1 |
| InChI | InChI=1S/C17H17BrFN3O2S/c18-14-5-6-17(20-7-14)21-8-12-10-22(11-13(12)9-21)25(23,24)16-4-2-1-3-15(16)19/h1-7,12-13H,8-11H2 |
| InChIKey | FJQFOMRWEHCPCS-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |