C17H20ClF3N4O — CID 163354486
3-[5-(5-chloro-2-pyridinyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-(2,2,2-trifluoroethyl)pyrrolidin-2-one (PubChem CID 163354486) has the molecular formula C17H20ClF3N4O and a molecular weight of 388.82 g/mol. Its IUPAC name is 3-[5-(5-chloro-2-pyridinyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-(2,2,2-trifluoroethyl)pyrrolidin-2-one.
| Compound Name | 3-[5-(5-chloro-2-pyridinyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-(2,2,2-trifluoroethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 163354486 |
| Molecular Formula | C17H20ClF3N4O |
| Molecular Weight | 388.82 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 3-[5-(5-chloro-2-pyridinyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-(2,2,2-trifluoroethyl)pyrrolidin-2-one |
| SMILES | O=C1C(N2CC3CN(c4ccc(Cl)cn4)CC3C2)CCN1CC(F)(F)F |
| InChI | InChI=1S/C17H20ClF3N4O/c18-13-1-2-15(22-5-13)25-8-11-6-24(7-12(11)9-25)14-3-4-23(16(14)26)10-17(19,20)21/h1-2,5,11-12,14H,3-4,6-10H2 |
| InChIKey | OQOPROTVJGNNCT-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.82 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |