About 3-[3-(4,4-difluoropiperidine-1-carbonyl)piperidin-1-yl]piperidin-2-one
3-[3-(4,4-difluoropiperidine-1-carbonyl)piperidin-1-yl]piperidin-2-one (PubChem CID 163354658) has the molecular formula C16H25F2N3O2
and a molecular weight of 329.39 g/mol. Its IUPAC name is 3-[3-(4,4-difluoropiperidine-1-carbonyl)piperidin-1-yl]piperidin-2-one.
Molecular Properties
| Compound Name | 3-[3-(4,4-difluoropiperidine-1-carbonyl)piperidin-1-yl]piperidin-2-one |
| PubChem CID | 163354658 |
| Molecular Formula | C16H25F2N3O2 |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | 3-[3-(4,4-difluoropiperidine-1-carbonyl)piperidin-1-yl]piperidin-2-one |
| SMILES | O=C1NCCCC1N1CCCC(C(=O)N2CCC(F)(F)CC2)C1 |
| InChI | InChI=1S/C16H25F2N3O2/c17-16(18)5-9-20(10-6-16)15(23)12-3-2-8-21(11-12)13-4-1-7-19-14(13)22/h12-13H,1-11H2,(H,19,22) |
| InChIKey | DAKDDGNPHKMXTJ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[3-(4,4-difluoropiperidine-1-carbonyl)piperidin-1-yl]piperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(4,4-difluoropiperidine-1-carbonyl)piperidin-1-yl]piperidin-2-one?
The IUPAC name of 3-[3-(4,4-difluoropiperidine-1-carbonyl)piperidin-1-yl]piperidin-2-one (CID 163354658) is 3-[3-(4,4-difluoropiperidine-1-carbonyl)piperidin-1-yl]piperidin-2-one.
What is the SMILES notation for 3-[3-(4,4-difluoropiperidine-1-carbonyl)piperidin-1-yl]piperidin-2-one?
The canonical SMILES for 3-[3-(4,4-difluoropiperidine-1-carbonyl)piperidin-1-yl]piperidin-2-one is O=C1NCCCC1N1CCCC(C(=O)N2CCC(F)(F)CC2)C1.
What is the InChIKey of 3-[3-(4,4-difluoropiperidine-1-carbonyl)piperidin-1-yl]piperidin-2-one?
The InChIKey is DAKDDGNPHKMXTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25F2N3O2/c17-16(18)5-9-20(10-6-16)15(23)12-3-2-8-21(11-12)13-4-1-7-19-14(13)22/h12-13H,1-11H2,(H,19,22).
What are the key properties of 3-[3-(4,4-difluoropiperidine-1-carbonyl)piperidin-1-yl]piperidin-2-one?
3-[3-(4,4-difluoropiperidine-1-carbonyl)piperidin-1-yl]piperidin-2-one has a molecular weight of 329.39 g/mol, XLogP of 1.23, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(4,4-difluoropiperidine-1-carbonyl)piperidin-1-yl]piperidin-2-one is sourced from PubChem (CID 163354658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).