C19H22FN5 — CID 163354705
5-(2-cyclopropyl-6-methylpyrimidin-4-yl)-2-(5-fluoro-2-pyridinyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 163354705) has the molecular formula C19H22FN5 and a molecular weight of 339.42 g/mol. Its IUPAC name is 5-(2-cyclopropyl-6-methylpyrimidin-4-yl)-2-(5-fluoro-2-pyridinyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | 5-(2-cyclopropyl-6-methylpyrimidin-4-yl)-2-(5-fluoro-2-pyridinyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 163354705 |
| Molecular Formula | C19H22FN5 |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | 5-(2-cyclopropyl-6-methylpyrimidin-4-yl)-2-(5-fluoro-2-pyridinyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | Cc1cc(N2CC3CN(c4ccc(F)cn4)CC3C2)nc(C2CC2)n1 |
| InChI | InChI=1S/C19H22FN5/c1-12-6-18(23-19(22-12)13-2-3-13)25-10-14-8-24(9-15(14)11-25)17-5-4-16(20)7-21-17/h4-7,13-15H,2-3,8-11H2,1H3 |
| InChIKey | PMZMJUDFNHXYOU-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |