C19H22F2N4O — CID 163354765
(4,4-difluoropiperidin-1-yl)-(1-quinoxalin-2-ylpiperidin-3-yl)methanone (PubChem CID 163354765) has the molecular formula C19H22F2N4O and a molecular weight of 360.41 g/mol. Its IUPAC name is (4,4-difluoropiperidin-1-yl)-(1-quinoxalin-2-ylpiperidin-3-yl)methanone.
| Compound Name | (4,4-difluoropiperidin-1-yl)-(1-quinoxalin-2-ylpiperidin-3-yl)methanone |
|---|---|
| PubChem CID | 163354765 |
| Molecular Formula | C19H22F2N4O |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | (4,4-difluoropiperidin-1-yl)-(1-quinoxalin-2-ylpiperidin-3-yl)methanone |
| SMILES | O=C(C1CCCN(c2cnc3ccccc3n2)C1)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C19H22F2N4O/c20-19(21)7-10-24(11-8-19)18(26)14-4-3-9-25(13-14)17-12-22-15-5-1-2-6-16(15)23-17/h1-2,5-6,12,14H,3-4,7-11,13H2 |
| InChIKey | HFSONZSNCSDUOE-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |