C21H24BrN3O — CID 163354891
5-(5-bromo-2-pyridinyl)-2-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 163354891) has the molecular formula C21H24BrN3O and a molecular weight of 414.35 g/mol. Its IUPAC name is 5-(5-bromo-2-pyridinyl)-2-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | 5-(5-bromo-2-pyridinyl)-2-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 163354891 |
| Molecular Formula | C21H24BrN3O |
| Molecular Weight | 414.35 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | 5-(5-bromo-2-pyridinyl)-2-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | Brc1ccc(N2CC3CN(CCc4ccc5c(c4)CCO5)CC3C2)nc1 |
| InChI | InChI=1S/C21H24BrN3O/c22-19-2-4-21(23-10-19)25-13-17-11-24(12-18(17)14-25)7-5-15-1-3-20-16(9-15)6-8-26-20/h1-4,9-10,17-18H,5-8,11-14H2 |
| InChIKey | NVZRPRCBMDONIP-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.35 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |