C39H62NO2PS — CID 163355349
(S)-N-[(S)-(3,5-ditert-butyl-4-methoxyphenyl)-(2-dicyclohexylphosphanylphenyl)methyl]-N,2-dimethylpropane-2-sulfinamide (PubChem CID 163355349) has the molecular formula C39H62NO2PS and a molecular weight of 639.97 g/mol. Its IUPAC name is (S)-N-[(S)-(3,5-ditert-butyl-4-methoxyphenyl)-(2-dicyclohexylphosphanylphenyl)methyl]-N,2-dimethylpropane-2-sulfinamide.
| Compound Name | (S)-N-[(S)-(3,5-ditert-butyl-4-methoxyphenyl)-(2-dicyclohexylphosphanylphenyl)methyl]-N,2-dimethylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 163355349 |
| Molecular Formula | C39H62NO2PS |
| Molecular Weight | 639.97 g/mol |
| Exact Mass | 639.42 |
| IUPAC Name | (S)-N-[(S)-(3,5-ditert-butyl-4-methoxyphenyl)-(2-dicyclohexylphosphanylphenyl)methyl]-N,2-dimethylpropane-2-sulfinamide |
| SMILES | COc1c(C(C)(C)C)cc([C@@H](c2ccccc2P(C2CCCCC2)C2CCCCC2)N(C)[S@@](=O)C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C39H62NO2PS/c1-37(2,3)32-26-28(27-33(36(32)42-11)38(4,5)6)35(40(10)44(41)39(7,8)9)31-24-18-19-25-34(31)43(29-20-14-12-15-21-29)30-22-16-13-17-23-30/h18-19,24-27,29-30,35H,12-17,20-23H2,1-11H3/t35-,44-/m0/s1 |
| InChIKey | SEAVUEGEEBNFGF-BTDRIEDLSA-N |
| XLogP | 10.55 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.97 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|