C16H20F3N5O2 — CID 163356309
1-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]-3-(2,2,2-trifluoroethyl)imidazolidine-2,4-dione (PubChem CID 163356309) has the molecular formula C16H20F3N5O2 and a molecular weight of 371.36 g/mol. Its IUPAC name is 1-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]-3-(2,2,2-trifluoroethyl)imidazolidine-2,4-dione.
| Compound Name | 1-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]-3-(2,2,2-trifluoroethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 163356309 |
| Molecular Formula | C16H20F3N5O2 |
| Molecular Weight | 371.36 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 1-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]-3-(2,2,2-trifluoroethyl)imidazolidine-2,4-dione |
| SMILES | CCc1cnc(N2CCC(N3CC(=O)N(CC(F)(F)F)C3=O)CC2)nc1 |
| InChI | InChI=1S/C16H20F3N5O2/c1-2-11-7-20-14(21-8-11)22-5-3-12(4-6-22)23-9-13(25)24(15(23)26)10-16(17,18)19/h7-8,12H,2-6,9-10H2,1H3 |
| InChIKey | SZGLYMYHUFDJFD-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.36 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|