C21H21FN8O — CID 163357374
2-[(4-fluorophenyl)methyl]-6-[4-(7-methylpurin-6-yl)piperazin-1-yl]pyridazin-3-one (PubChem CID 163357374) has the molecular formula C21H21FN8O and a molecular weight of 420.45 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methyl]-6-[4-(7-methylpurin-6-yl)piperazin-1-yl]pyridazin-3-one.
| Compound Name | 2-[(4-fluorophenyl)methyl]-6-[4-(7-methylpurin-6-yl)piperazin-1-yl]pyridazin-3-one |
|---|---|
| PubChem CID | 163357374 |
| Molecular Formula | C21H21FN8O |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 2-[(4-fluorophenyl)methyl]-6-[4-(7-methylpurin-6-yl)piperazin-1-yl]pyridazin-3-one |
| SMILES | Cn1cnc2ncnc(N3CCN(c4ccc(=O)n(Cc5ccc(F)cc5)n4)CC3)c21 |
| InChI | InChI=1S/C21H21FN8O/c1-27-14-25-20-19(27)21(24-13-23-20)29-10-8-28(9-11-29)17-6-7-18(31)30(26-17)12-15-2-4-16(22)5-3-15/h2-7,13-14H,8-12H2,1H3 |
| InChIKey | CLTZKGHJOCFMGS-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 84.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |