C12H12F4N2O — CID 163357389
N-(4-fluorophenyl)-2-[3-(trifluoromethyl)azetidin-1-yl]acetamide (PubChem CID 163357389) has the molecular formula C12H12F4N2O and a molecular weight of 276.23 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[3-(trifluoromethyl)azetidin-1-yl]acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[3-(trifluoromethyl)azetidin-1-yl]acetamide |
|---|---|
| PubChem CID | 163357389 |
| Molecular Formula | C12H12F4N2O |
| Molecular Weight | 276.23 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | N-(4-fluorophenyl)-2-[3-(trifluoromethyl)azetidin-1-yl]acetamide |
| SMILES | O=C(CN1CC(C(F)(F)F)C1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C12H12F4N2O/c13-9-1-3-10(4-2-9)17-11(19)7-18-5-8(6-18)12(14,15)16/h1-4,8H,5-7H2,(H,17,19) |
| InChIKey | MPTMWUDVOMFZFF-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.23 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |