C15H11FN4O2 — CID 163358343
2-but-2-ynyl-7-(3-fluorophenyl)-[1,2,4]triazolo[4,3-a]pyrazine-3,8-dione (PubChem CID 163358343) has the molecular formula C15H11FN4O2 and a molecular weight of 298.28 g/mol. Its IUPAC name is 2-but-2-ynyl-7-(3-fluorophenyl)-[1,2,4]triazolo[4,3-a]pyrazine-3,8-dione.
| Compound Name | 2-but-2-ynyl-7-(3-fluorophenyl)-[1,2,4]triazolo[4,3-a]pyrazine-3,8-dione |
|---|---|
| PubChem CID | 163358343 |
| Molecular Formula | C15H11FN4O2 |
| Molecular Weight | 298.28 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 2-but-2-ynyl-7-(3-fluorophenyl)-[1,2,4]triazolo[4,3-a]pyrazine-3,8-dione |
| SMILES | CC#CCn1nc2c(=O)n(-c3cccc(F)c3)ccn2c1=O |
| InChI | InChI=1S/C15H11FN4O2/c1-2-3-7-20-15(22)19-9-8-18(14(21)13(19)17-20)12-6-4-5-11(16)10-12/h4-6,8-10H,7H2,1H3 |
| InChIKey | SULUVWJMMREFJY-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 61.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.28 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|