About 5,7-dimethyl-1-(oxiran-2-ylmethyl)-2,3-diphenylindole
5,7-dimethyl-1-(oxiran-2-ylmethyl)-2,3-diphenylindole (PubChem CID 163358496) has the molecular formula C25H23NO
and a molecular weight of 353.47 g/mol. Its IUPAC name is 5,7-dimethyl-1-(oxiran-2-ylmethyl)-2,3-diphenylindole.
Molecular Properties
| Compound Name | 5,7-dimethyl-1-(oxiran-2-ylmethyl)-2,3-diphenylindole |
| PubChem CID | 163358496 |
| Molecular Formula | C25H23NO |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | 5,7-dimethyl-1-(oxiran-2-ylmethyl)-2,3-diphenylindole |
| SMILES | Cc1cc(C)c2c(c1)c(-c1ccccc1)c(-c1ccccc1)n2CC1CO1 |
| InChI | InChI=1S/C25H23NO/c1-17-13-18(2)24-22(14-17)23(19-9-5-3-6-10-19)25(20-11-7-4-8-12-20)26(24)15-21-16-27-21/h3-14,21H,15-16H2,1-2H3 |
| InChIKey | XSSQDZHOZAHNGJ-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 17.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 5,7-dimethyl-1-(oxiran-2-ylmethyl)-2,3-diphenylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dimethyl-1-(oxiran-2-ylmethyl)-2,3-diphenylindole?
The IUPAC name of 5,7-dimethyl-1-(oxiran-2-ylmethyl)-2,3-diphenylindole (CID 163358496) is 5,7-dimethyl-1-(oxiran-2-ylmethyl)-2,3-diphenylindole.
What is the SMILES notation for 5,7-dimethyl-1-(oxiran-2-ylmethyl)-2,3-diphenylindole?
The canonical SMILES for 5,7-dimethyl-1-(oxiran-2-ylmethyl)-2,3-diphenylindole is Cc1cc(C)c2c(c1)c(-c1ccccc1)c(-c1ccccc1)n2CC1CO1.
What is the InChIKey of 5,7-dimethyl-1-(oxiran-2-ylmethyl)-2,3-diphenylindole?
The InChIKey is XSSQDZHOZAHNGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H23NO/c1-17-13-18(2)24-22(14-17)23(19-9-5-3-6-10-19)25(20-11-7-4-8-12-20)26(24)15-21-16-27-21/h3-14,21H,15-16H2,1-2H3.
What are the key properties of 5,7-dimethyl-1-(oxiran-2-ylmethyl)-2,3-diphenylindole?
5,7-dimethyl-1-(oxiran-2-ylmethyl)-2,3-diphenylindole has a molecular weight of 353.47 g/mol, XLogP of 5.99, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dimethyl-1-(oxiran-2-ylmethyl)-2,3-diphenylindole is sourced from PubChem (CID 163358496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).