C23H28N2O8 — CID 163358543
2,3-dihydroxybutanedioic acid;4-[(R)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-hydroxymethyl]quinolin-6-ol (PubChem CID 163358543) has the molecular formula C23H28N2O8 and a molecular weight of 460.48 g/mol. Its IUPAC name is 2,3-dihydroxybutanedioic acid;4-[(R)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-hydroxymethyl]quinolin-6-ol.
| Compound Name | 2,3-dihydroxybutanedioic acid;4-[(R)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-hydroxymethyl]quinolin-6-ol |
|---|---|
| PubChem CID | 163358543 |
| Molecular Formula | C23H28N2O8 |
| Molecular Weight | 460.48 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | 2,3-dihydroxybutanedioic acid;4-[(R)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-hydroxymethyl]quinolin-6-ol |
| SMILES | C=CC1CN2CCC1CC2[C@H](O)c1ccnc2ccc(O)cc12.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C19H22N2O2.C4H6O6/c1-2-12-11-21-8-6-13(12)9-18(21)19(23)15-5-7-20-17-4-3-14(22)10-16(15)17;5-1(3(7)8)2(6)4(9)10/h2-5,7,10,12-13,18-19,22-23H,1,6,8-9,11H2;1-2,5-6H,(H,7,8)(H,9,10)/t12?,13?,18?,19-;/m1./s1 |
| InChIKey | COUFDTBSIXKHBC-YVCVWVFBSA-N |
| XLogP | 0.75 |
| TPSA | 171.65 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.48 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|