C13H17N3O4 — CID 163358790
5-[(2Z,4E)-5-(dimethylamino)-2-hydroxypenta-2,4-dienylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 163358790) has the molecular formula C13H17N3O4 and a molecular weight of 279.30 g/mol. Its IUPAC name is 5-[(2Z,4E)-5-(dimethylamino)-2-hydroxypenta-2,4-dienylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(2Z,4E)-5-(dimethylamino)-2-hydroxypenta-2,4-dienylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 163358790 |
| Molecular Formula | C13H17N3O4 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 5-[(2Z,4E)-5-(dimethylamino)-2-hydroxypenta-2,4-dienylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CN(C)/C=C/C=C(\O)C=C1C(=O)N(C)C(=O)N(C)C1=O |
| InChI | InChI=1S/C13H17N3O4/c1-14(2)7-5-6-9(17)8-10-11(18)15(3)13(20)16(4)12(10)19/h5-8,17H,1-4H3/b7-5+,9-6- |
| InChIKey | OOGGLNJIIBFLGY-BEDCHXNXSA-N |
| XLogP | 0.48 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|