About (E)-1-(2,6-dichlorophenyl)-N-ethoxypropan-2-imine
(E)-1-(2,6-dichlorophenyl)-N-ethoxypropan-2-imine (PubChem CID 163358824) has the molecular formula C11H13Cl2NO
and a molecular weight of 246.14 g/mol. Its IUPAC name is (E)-1-(2,6-dichlorophenyl)-N-ethoxypropan-2-imine.
Molecular Properties
| Compound Name | (E)-1-(2,6-dichlorophenyl)-N-ethoxypropan-2-imine |
| PubChem CID | 163358824 |
| Molecular Formula | C11H13Cl2NO |
| Molecular Weight | 246.14 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | (E)-1-(2,6-dichlorophenyl)-N-ethoxypropan-2-imine |
| SMILES | CCO/N=C(\C)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C11H13Cl2NO/c1-3-15-14-8(2)7-9-10(12)5-4-6-11(9)13/h4-6H,3,7H2,1-2H3/b14-8+ |
| InChIKey | VGRBRJSLLZTRFD-RIYZIHGNSA-N |
| XLogP | 3.95 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.14 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-(2,6-dichlorophenyl)-N-ethoxypropan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-(2,6-dichlorophenyl)-N-ethoxypropan-2-imine?
The IUPAC name of (E)-1-(2,6-dichlorophenyl)-N-ethoxypropan-2-imine (CID 163358824) is (E)-1-(2,6-dichlorophenyl)-N-ethoxypropan-2-imine.
What is the SMILES notation for (E)-1-(2,6-dichlorophenyl)-N-ethoxypropan-2-imine?
The canonical SMILES for (E)-1-(2,6-dichlorophenyl)-N-ethoxypropan-2-imine is CCO/N=C(\C)Cc1c(Cl)cccc1Cl.
What is the InChIKey of (E)-1-(2,6-dichlorophenyl)-N-ethoxypropan-2-imine?
The InChIKey is VGRBRJSLLZTRFD-RIYZIHGNSA-N. The full InChI is InChI=1S/C11H13Cl2NO/c1-3-15-14-8(2)7-9-10(12)5-4-6-11(9)13/h4-6H,3,7H2,1-2H3/b14-8+.
What are the key properties of (E)-1-(2,6-dichlorophenyl)-N-ethoxypropan-2-imine?
(E)-1-(2,6-dichlorophenyl)-N-ethoxypropan-2-imine has a molecular weight of 246.14 g/mol, XLogP of 3.95, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-(2,6-dichlorophenyl)-N-ethoxypropan-2-imine is sourced from PubChem (CID 163358824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).