C10H9F6NO — CID 163358845
N-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]ethyl]hydroxylamine (PubChem CID 163358845) has the molecular formula C10H9F6NO and a molecular weight of 273.18 g/mol. Its IUPAC name is N-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]ethyl]hydroxylamine.
| Compound Name | N-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]ethyl]hydroxylamine |
|---|---|
| PubChem CID | 163358845 |
| Molecular Formula | C10H9F6NO |
| Molecular Weight | 273.18 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | N-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]ethyl]hydroxylamine |
| SMILES | C[C@H](NO)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H9F6NO/c1-5(17-18)6-2-7(9(11,12)13)4-8(3-6)10(14,15)16/h2-5,17-18H,1H3/t5-/m0/s1 |
| InChIKey | CXWUVDJJRLDQFH-YFKPBYRVSA-N |
| XLogP | 3.76 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.18 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|