About 3-acridin-4-yl-1,5-bis(4-bromophenyl)pentane-1,5-dione
3-acridin-4-yl-1,5-bis(4-bromophenyl)pentane-1,5-dione (PubChem CID 163359221) has the molecular formula C30H21Br2NO2
and a molecular weight of 587.31 g/mol. Its IUPAC name is 3-acridin-4-yl-1,5-bis(4-bromophenyl)pentane-1,5-dione.
Molecular Properties
| Compound Name | 3-acridin-4-yl-1,5-bis(4-bromophenyl)pentane-1,5-dione |
| PubChem CID | 163359221 |
| Molecular Formula | C30H21Br2NO2 |
| Molecular Weight | 587.31 g/mol |
| Exact Mass | 584.99 |
| IUPAC Name | 3-acridin-4-yl-1,5-bis(4-bromophenyl)pentane-1,5-dione |
| SMILES | O=C(CC(CC(=O)c1ccc(Br)cc1)c1cccc2cc3ccccc3nc12)c1ccc(Br)cc1 |
| InChI | InChI=1S/C30H21Br2NO2/c31-24-12-8-19(9-13-24)28(34)17-23(18-29(35)20-10-14-25(32)15-11-20)26-6-3-5-22-16-21-4-1-2-7-27(21)33-30(22)26/h1-16,23H,17-18H2 |
| InChIKey | ZDNLEUNYXYFGTH-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 587.31 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 3-acridin-4-yl-1,5-bis(4-bromophenyl)pentane-1,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acridin-4-yl-1,5-bis(4-bromophenyl)pentane-1,5-dione?
The IUPAC name of 3-acridin-4-yl-1,5-bis(4-bromophenyl)pentane-1,5-dione (CID 163359221) is 3-acridin-4-yl-1,5-bis(4-bromophenyl)pentane-1,5-dione.
What is the SMILES notation for 3-acridin-4-yl-1,5-bis(4-bromophenyl)pentane-1,5-dione?
The canonical SMILES for 3-acridin-4-yl-1,5-bis(4-bromophenyl)pentane-1,5-dione is O=C(CC(CC(=O)c1ccc(Br)cc1)c1cccc2cc3ccccc3nc12)c1ccc(Br)cc1.
What is the InChIKey of 3-acridin-4-yl-1,5-bis(4-bromophenyl)pentane-1,5-dione?
The InChIKey is ZDNLEUNYXYFGTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H21Br2NO2/c31-24-12-8-19(9-13-24)28(34)17-23(18-29(35)20-10-14-25(32)15-11-20)26-6-3-5-22-16-21-4-1-2-7-27(21)33-30(22)26/h1-16,23H,17-18H2.
What are the key properties of 3-acridin-4-yl-1,5-bis(4-bromophenyl)pentane-1,5-dione?
3-acridin-4-yl-1,5-bis(4-bromophenyl)pentane-1,5-dione has a molecular weight of 587.31 g/mol, XLogP of 8.54, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acridin-4-yl-1,5-bis(4-bromophenyl)pentane-1,5-dione is sourced from PubChem (CID 163359221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).