About 7-(4-amino-1,3-thiazol-2-yl)-3,4-dihydro-2H-naphthalen-1-one
7-(4-amino-1,3-thiazol-2-yl)-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 163359622) has the molecular formula C13H12N2OS
and a molecular weight of 244.32 g/mol. Its IUPAC name is 7-(4-amino-1,3-thiazol-2-yl)-3,4-dihydro-2H-naphthalen-1-one.
Molecular Properties
| Compound Name | 7-(4-amino-1,3-thiazol-2-yl)-3,4-dihydro-2H-naphthalen-1-one |
| PubChem CID | 163359622 |
| Molecular Formula | C13H12N2OS |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 7-(4-amino-1,3-thiazol-2-yl)-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | Nc1csc(-c2ccc3c(c2)C(=O)CCC3)n1 |
| InChI | InChI=1S/C13H12N2OS/c14-12-7-17-13(15-12)9-5-4-8-2-1-3-11(16)10(8)6-9/h4-7H,1-3,14H2 |
| InChIKey | RGPHVRGQJFYTLQ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-(4-amino-1,3-thiazol-2-yl)-3,4-dihydro-2H-naphthalen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(4-amino-1,3-thiazol-2-yl)-3,4-dihydro-2H-naphthalen-1-one?
The IUPAC name of 7-(4-amino-1,3-thiazol-2-yl)-3,4-dihydro-2H-naphthalen-1-one (CID 163359622) is 7-(4-amino-1,3-thiazol-2-yl)-3,4-dihydro-2H-naphthalen-1-one.
What is the SMILES notation for 7-(4-amino-1,3-thiazol-2-yl)-3,4-dihydro-2H-naphthalen-1-one?
The canonical SMILES for 7-(4-amino-1,3-thiazol-2-yl)-3,4-dihydro-2H-naphthalen-1-one is Nc1csc(-c2ccc3c(c2)C(=O)CCC3)n1.
What is the InChIKey of 7-(4-amino-1,3-thiazol-2-yl)-3,4-dihydro-2H-naphthalen-1-one?
The InChIKey is RGPHVRGQJFYTLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2OS/c14-12-7-17-13(15-12)9-5-4-8-2-1-3-11(16)10(8)6-9/h4-7H,1-3,14H2.
What are the key properties of 7-(4-amino-1,3-thiazol-2-yl)-3,4-dihydro-2H-naphthalen-1-one?
7-(4-amino-1,3-thiazol-2-yl)-3,4-dihydro-2H-naphthalen-1-one has a molecular weight of 244.32 g/mol, XLogP of 2.91, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(4-amino-1,3-thiazol-2-yl)-3,4-dihydro-2H-naphthalen-1-one is sourced from PubChem (CID 163359622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).