About [(E)-1-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonyl]dec-2-en-5-yl] benzoate
[(E)-1-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonyl]dec-2-en-5-yl] benzoate (PubChem CID 163359690) has the molecular formula C27H38O5S
and a molecular weight of 474.66 g/mol. Its IUPAC name is [(E)-1-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonyl]dec-2-en-5-yl] benzoate.
Molecular Properties
| Compound Name | [(E)-1-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonyl]dec-2-en-5-yl] benzoate |
| PubChem CID | 163359690 |
| Molecular Formula | C27H38O5S |
| Molecular Weight | 474.66 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | [(E)-1-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonyl]dec-2-en-5-yl] benzoate |
| SMILES | CCCCCC(C/C=C/CS(=O)(=O)CC12CCC(CC1=O)C2(C)C)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H38O5S/c1-4-5-7-14-23(32-25(29)21-12-8-6-9-13-21)15-10-11-18-33(30,31)20-27-17-16-22(19-24(27)28)26(27,2)3/h6,8-13,22-23H,4-5,7,14-20H2,1-3H3/b11-10+ |
| InChIKey | GUUAMEQARONDGH-ZHACJKMWSA-N |
| XLogP | 5.55 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 474.66 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(E)-1-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonyl]dec-2-en-5-yl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-1-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonyl]dec-2-en-5-yl] benzoate?
The IUPAC name of [(E)-1-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonyl]dec-2-en-5-yl] benzoate (CID 163359690) is [(E)-1-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonyl]dec-2-en-5-yl] benzoate.
What is the SMILES notation for [(E)-1-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonyl]dec-2-en-5-yl] benzoate?
The canonical SMILES for [(E)-1-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonyl]dec-2-en-5-yl] benzoate is CCCCCC(C/C=C/CS(=O)(=O)CC12CCC(CC1=O)C2(C)C)OC(=O)c1ccccc1.
What is the InChIKey of [(E)-1-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonyl]dec-2-en-5-yl] benzoate?
The InChIKey is GUUAMEQARONDGH-ZHACJKMWSA-N. The full InChI is InChI=1S/C27H38O5S/c1-4-5-7-14-23(32-25(29)21-12-8-6-9-13-21)15-10-11-18-33(30,31)20-27-17-16-22(19-24(27)28)26(27,2)3/h6,8-13,22-23H,4-5,7,14-20H2,1-3H3/b11-10+.
What are the key properties of [(E)-1-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonyl]dec-2-en-5-yl] benzoate?
[(E)-1-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonyl]dec-2-en-5-yl] benzoate has a molecular weight of 474.66 g/mol, XLogP of 5.55, 12 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-1-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonyl]dec-2-en-5-yl] benzoate is sourced from PubChem (CID 163359690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).