C25H27F3O4S — CID 163359696
[(E)-1-cyclohexyl-5-[4-(trifluoromethyl)phenyl]sulfonylpent-3-enyl] benzoate (PubChem CID 163359696) has the molecular formula C25H27F3O4S and a molecular weight of 480.55 g/mol. Its IUPAC name is [(E)-1-cyclohexyl-5-[4-(trifluoromethyl)phenyl]sulfonylpent-3-enyl] benzoate.
| Compound Name | [(E)-1-cyclohexyl-5-[4-(trifluoromethyl)phenyl]sulfonylpent-3-enyl] benzoate |
|---|---|
| PubChem CID | 163359696 |
| Molecular Formula | C25H27F3O4S |
| Molecular Weight | 480.55 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | [(E)-1-cyclohexyl-5-[4-(trifluoromethyl)phenyl]sulfonylpent-3-enyl] benzoate |
| SMILES | O=C(OC(C/C=C/CS(=O)(=O)c1ccc(C(F)(F)F)cc1)C1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C25H27F3O4S/c26-25(27,28)21-14-16-22(17-15-21)33(30,31)18-8-7-13-23(19-9-3-1-4-10-19)32-24(29)20-11-5-2-6-12-20/h2,5-8,11-12,14-17,19,23H,1,3-4,9-10,13,18H2/b8-7+ |
| InChIKey | OARVUWGOBOWWOR-BQYQJAHWSA-N |
| XLogP | 6.23 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.55 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|