About 2-ethylhexyl 2-[1-[4-[1-[2-(2-ethylhexoxy)-2-oxoethyl]sulfanylethoxy]butoxy]ethylsulfanyl]acetate
2-ethylhexyl 2-[1-[4-[1-[2-(2-ethylhexoxy)-2-oxoethyl]sulfanylethoxy]butoxy]ethylsulfanyl]acetate (PubChem CID 163360414) has the molecular formula C28H54O6S2
and a molecular weight of 550.87 g/mol. Its IUPAC name is 2-ethylhexyl 2-[1-[4-[1-[2-(2-ethylhexoxy)-2-oxoethyl]sulfanylethoxy]butoxy]ethylsulfanyl]acetate.
Molecular Properties
| Compound Name | 2-ethylhexyl 2-[1-[4-[1-[2-(2-ethylhexoxy)-2-oxoethyl]sulfanylethoxy]butoxy]ethylsulfanyl]acetate |
| PubChem CID | 163360414 |
| Molecular Formula | C28H54O6S2 |
| Molecular Weight | 550.87 g/mol |
| Exact Mass | 550.34 |
| IUPAC Name | 2-ethylhexyl 2-[1-[4-[1-[2-(2-ethylhexoxy)-2-oxoethyl]sulfanylethoxy]butoxy]ethylsulfanyl]acetate |
| SMILES | CCCCC(CC)COC(=O)CSC(C)OCCCCOC(C)SCC(=O)OCC(CC)CCCC |
| InChI | InChI=1S/C28H54O6S2/c1-7-11-15-25(9-3)19-33-27(29)21-35-23(5)31-17-13-14-18-32-24(6)36-22-28(30)34-20-26(10-4)16-12-8-2/h23-26H,7-22H2,1-6H3 |
| InChIKey | KDXOYRRIHZWIRF-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 550.87 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylhexyl 2-[1-[4-[1-[2-(2-ethylhexoxy)-2-oxoethyl]sulfanylethoxy]butoxy]ethylsulfanyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexyl 2-[1-[4-[1-[2-(2-ethylhexoxy)-2-oxoethyl]sulfanylethoxy]butoxy]ethylsulfanyl]acetate?
The IUPAC name of 2-ethylhexyl 2-[1-[4-[1-[2-(2-ethylhexoxy)-2-oxoethyl]sulfanylethoxy]butoxy]ethylsulfanyl]acetate (CID 163360414) is 2-ethylhexyl 2-[1-[4-[1-[2-(2-ethylhexoxy)-2-oxoethyl]sulfanylethoxy]butoxy]ethylsulfanyl]acetate.
What is the SMILES notation for 2-ethylhexyl 2-[1-[4-[1-[2-(2-ethylhexoxy)-2-oxoethyl]sulfanylethoxy]butoxy]ethylsulfanyl]acetate?
The canonical SMILES for 2-ethylhexyl 2-[1-[4-[1-[2-(2-ethylhexoxy)-2-oxoethyl]sulfanylethoxy]butoxy]ethylsulfanyl]acetate is CCCCC(CC)COC(=O)CSC(C)OCCCCOC(C)SCC(=O)OCC(CC)CCCC.
What is the InChIKey of 2-ethylhexyl 2-[1-[4-[1-[2-(2-ethylhexoxy)-2-oxoethyl]sulfanylethoxy]butoxy]ethylsulfanyl]acetate?
The InChIKey is KDXOYRRIHZWIRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H54O6S2/c1-7-11-15-25(9-3)19-33-27(29)21-35-23(5)31-17-13-14-18-32-24(6)36-22-28(30)34-20-26(10-4)16-12-8-2/h23-26H,7-22H2,1-6H3.
What are the key properties of 2-ethylhexyl 2-[1-[4-[1-[2-(2-ethylhexoxy)-2-oxoethyl]sulfanylethoxy]butoxy]ethylsulfanyl]acetate?
2-ethylhexyl 2-[1-[4-[1-[2-(2-ethylhexoxy)-2-oxoethyl]sulfanylethoxy]butoxy]ethylsulfanyl]acetate has a molecular weight of 550.87 g/mol, XLogP of 7.48, 25 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexyl 2-[1-[4-[1-[2-(2-ethylhexoxy)-2-oxoethyl]sulfanylethoxy]butoxy]ethylsulfanyl]acetate is sourced from PubChem (CID 163360414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).