C14H26O4 — CID 163360484
(3S,3aR,6R,6aR)-3,6-bis(2-methylpropoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan (PubChem CID 163360484) has the molecular formula C14H26O4 and a molecular weight of 258.36 g/mol. Its IUPAC name is (3S,3aR,6R,6aR)-3,6-bis(2-methylpropoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan.
| Compound Name | (3S,3aR,6R,6aR)-3,6-bis(2-methylpropoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
|---|---|
| PubChem CID | 163360484 |
| Molecular Formula | C14H26O4 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | (3S,3aR,6R,6aR)-3,6-bis(2-methylpropoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
| SMILES | CC(C)CO[C@H]1CO[C@H]2[C@@H]1OC[C@H]2OCC(C)C |
| InChI | InChI=1S/C14H26O4/c1-9(2)5-15-11-7-17-14-12(8-18-13(11)14)16-6-10(3)4/h9-14H,5-8H2,1-4H3/t11-,12+,13-,14-/m1/s1 |
| InChIKey | FJPRNGSGTISKRU-XJFOESAGSA-N |
| XLogP | 1.87 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |