C14H26O4 — CID 163360487
(3S,3aR,6S,6aS)-3,6-dibutoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan (PubChem CID 163360487) has the molecular formula C14H26O4 and a molecular weight of 258.36 g/mol. Its IUPAC name is (3S,3aR,6S,6aS)-3,6-dibutoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan.
| Compound Name | (3S,3aR,6S,6aS)-3,6-dibutoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
|---|---|
| PubChem CID | 163360487 |
| Molecular Formula | C14H26O4 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | (3S,3aR,6S,6aS)-3,6-dibutoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
| SMILES | CCCCO[C@H]1CO[C@H]2[C@H]1OC[C@@H]2OCCCC |
| InChI | InChI=1S/C14H26O4/c1-3-5-7-15-11-9-17-14-12(10-18-13(11)14)16-8-6-4-2/h11-14H,3-10H2,1-2H3/t11-,12-,13-,14+/m0/s1 |
| InChIKey | OXDOLYXIPWAERZ-XDQVBPFNSA-N |
| XLogP | 2.15 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|