C12H22O4 — CID 163360488
(3S,3aR,6S,6aS)-3,6-dipropoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan (PubChem CID 163360488) has the molecular formula C12H22O4 and a molecular weight of 230.30 g/mol. Its IUPAC name is (3S,3aR,6S,6aS)-3,6-dipropoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan.
| Compound Name | (3S,3aR,6S,6aS)-3,6-dipropoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
|---|---|
| PubChem CID | 163360488 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | (3S,3aR,6S,6aS)-3,6-dipropoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
| SMILES | CCCO[C@H]1CO[C@H]2[C@H]1OC[C@@H]2OCCC |
| InChI | InChI=1S/C12H22O4/c1-3-5-13-9-7-15-12-10(14-6-4-2)8-16-11(9)12/h9-12H,3-8H2,1-2H3/t9-,10-,11-,12+/m0/s1 |
| InChIKey | QMSQLXJHBCGUAJ-FIQHERPVSA-N |
| XLogP | 1.37 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |